C13H13F3N2O2 — CID 63095739
2-methyl-7-[2,2,2-trifluoro-1-(methylamino)ethyl]-4H-isoquinoline-1,3-dione (PubChem CID 63095739) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-methyl-7-[2,2,2-trifluoro-1-(methylamino)ethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-methyl-7-[2,2,2-trifluoro-1-(methylamino)ethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 63095739 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-methyl-7-[2,2,2-trifluoro-1-(methylamino)ethyl]-4H-isoquinoline-1,3-dione |
| SMILES | CNC(c1ccc2c(c1)C(=O)N(C)C(=O)C2)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2/c1-17-11(13(14,15)16)8-4-3-7-6-10(19)18(2)12(20)9(7)5-8/h3-5,11,17H,6H2,1-2H3 |
| InChIKey | IDKTUTNNFFYKAV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|