C13H21N5O2S — CID 63096823
3-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-butan-2-ylpyrrolidine-2,5-dione (PubChem CID 63096823) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-butan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-butan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 63096823 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-butan-2-ylpyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)CC(Sc2nnc(N)n2C(C)C)C1=O |
| InChI | InChI=1S/C13H21N5O2S/c1-5-8(4)18-10(19)6-9(11(18)20)21-13-16-15-12(14)17(13)7(2)3/h7-9H,5-6H2,1-4H3,(H2,14,15) |
| InChIKey | QZUPDEKXELEUAI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|