About 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol
6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 63097112) has the molecular formula C9H8F2O3
and a molecular weight of 202.16 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol |
| PubChem CID | 63097112 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | OC1COc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C9H8F2O3/c10-9(11)14-5-1-2-6-7(12)4-13-8(6)3-5/h1-3,7,9,12H,4H2 |
| InChIKey | AUMIXGSKFODIOV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol?
The IUPAC name of 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol (CID 63097112) is 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol.
What is the SMILES notation for 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol?
The canonical SMILES for 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol is OC1COc2cc(OC(F)F)ccc21.
What is the InChIKey of 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol?
The InChIKey is AUMIXGSKFODIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O3/c10-9(11)14-5-1-2-6-7(12)4-13-8(6)3-5/h1-3,7,9,12H,4H2.
What are the key properties of 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol?
6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol has a molecular weight of 202.16 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran-3-ol is sourced from PubChem (CID 63097112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).