C10H17F3N4OS — CID 63097183
4-propan-2-yl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 63097183) has the molecular formula C10H17F3N4OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-propan-2-yl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-propan-2-yl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 63097183 |
| Molecular Formula | C10H17F3N4OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-propan-2-yl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | CC(C)n1c(N)nnc1SCCCOCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N4OS/c1-7(2)17-8(14)15-16-9(17)19-5-3-4-18-6-10(11,12)13/h7H,3-6H2,1-2H3,(H2,14,15) |
| InChIKey | LLKRCLHXHWKEQS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|