About (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine
(3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 63097229) has the molecular formula C12H11N5
and a molecular weight of 225.25 g/mol. Its IUPAC name is (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine |
| PubChem CID | 63097229 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | NCc1nc(-c2ccc3ncccc3c2)n[nH]1 |
| InChI | InChI=1S/C12H11N5/c13-7-11-15-12(17-16-11)9-3-4-10-8(6-9)2-1-5-14-10/h1-6H,7,13H2,(H,15,16,17) |
| InChIKey | XXGKGVSJBLWMSD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine?
The IUPAC name of (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine (CID 63097229) is (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine.
What is the SMILES notation for (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine?
The canonical SMILES for (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine is NCc1nc(-c2ccc3ncccc3c2)n[nH]1.
What is the InChIKey of (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine?
The InChIKey is XXGKGVSJBLWMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c13-7-11-15-12(17-16-11)9-3-4-10-8(6-9)2-1-5-14-10/h1-6H,7,13H2,(H,15,16,17).
What are the key properties of (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine?
(3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine has a molecular weight of 225.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-quinolin-6-yl-1H-1,2,4-triazol-5-yl)methanamine is sourced from PubChem (CID 63097229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).