4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid

C12H14F2O3S — CID 63098247

IUPAC4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid
SMILESCCOC(CCSc1ccc(F)c(F)c1)C(=O)O
InChIInChI=1S/C12H14F2O3S/c1-2-17-11(12(15)16)5-6-18-8-3-4-9(13)10(14)7-8/h3-4,7,11H,2,5-6H2,1H3,(H,15,16)
InChIKeyOXYHFPVYLGGBJQ-UHFFFAOYSA-N
MW276.30 g/mol
LogP2.94
Rot. Bonds7

About 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid

4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid (PubChem CID 63098247) has the molecular formula C12H14F2O3S and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid.

Molecular Properties

Compound Name4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid
PubChem CID63098247
Molecular FormulaC12H14F2O3S
Molecular Weight276.30 g/mol
Exact Mass276.06
IUPAC Name4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid
SMILESCCOC(CCSc1ccc(F)c(F)c1)C(=O)O
InChIInChI=1S/C12H14F2O3S/c1-2-17-11(12(15)16)5-6-18-8-3-4-9(13)10(14)7-8/h3-4,7,11H,2,5-6H2,1H3,(H,15,16)
InChIKeyOXYHFPVYLGGBJQ-UHFFFAOYSA-N
XLogP2.94
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.30
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid?
The IUPAC name of 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid (CID 63098247) is 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid.
What is the SMILES notation for 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid?
The canonical SMILES for 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid is CCOC(CCSc1ccc(F)c(F)c1)C(=O)O.
What is the InChIKey of 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid?
The InChIKey is OXYHFPVYLGGBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O3S/c1-2-17-11(12(15)16)5-6-18-8-3-4-9(13)10(14)7-8/h3-4,7,11H,2,5-6H2,1H3,(H,15,16).
What are the key properties of 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid?
4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid has a molecular weight of 276.30 g/mol, XLogP of 2.94, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)sulfanyl-2-ethoxybutanoic acid is sourced from PubChem (CID 63098247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).