About 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid
2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid (PubChem CID 63098255) has the molecular formula C9H14N2O3S2
and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid.
Molecular Properties
| Compound Name | 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid |
| PubChem CID | 63098255 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid |
| SMILES | CCOC(CCSc1nnc(C)s1)C(=O)O |
| InChI | InChI=1S/C9H14N2O3S2/c1-3-14-7(8(12)13)4-5-15-9-11-10-6(2)16-9/h7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | CSLIVKFZVLLWTA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid?
The IUPAC name of 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid (CID 63098255) is 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid.
What is the SMILES notation for 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid?
The canonical SMILES for 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid is CCOC(CCSc1nnc(C)s1)C(=O)O.
What is the InChIKey of 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid?
The InChIKey is CSLIVKFZVLLWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S2/c1-3-14-7(8(12)13)4-5-15-9-11-10-6(2)16-9/h7H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid?
2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid has a molecular weight of 262.36 g/mol, XLogP of 1.82, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanoic acid is sourced from PubChem (CID 63098255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).