C13H18N4OS — CID 63098498
N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]oxan-4-amine (PubChem CID 63098498) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]oxan-4-amine.
| Compound Name | N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 63098498 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]oxan-4-amine |
| SMILES | c1ccn2c(SCCNC3CCOCC3)nnc2c1 |
| InChI | InChI=1S/C13H18N4OS/c1-2-7-17-12(3-1)15-16-13(17)19-10-6-14-11-4-8-18-9-5-11/h1-3,7,11,14H,4-6,8-10H2 |
| InChIKey | JWFQDCNQQDDVLF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|