C14H16FNO — CID 63099917
5-fluoro-N-[1-(furan-2-yl)propan-2-yl]-2-methylaniline (PubChem CID 63099917) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is 5-fluoro-N-[1-(furan-2-yl)propan-2-yl]-2-methylaniline.
| Compound Name | 5-fluoro-N-[1-(furan-2-yl)propan-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 63099917 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-fluoro-N-[1-(furan-2-yl)propan-2-yl]-2-methylaniline |
| SMILES | Cc1ccc(F)cc1NC(C)Cc1ccco1 |
| InChI | InChI=1S/C14H16FNO/c1-10-5-6-12(15)9-14(10)16-11(2)8-13-4-3-7-17-13/h3-7,9,11,16H,8H2,1-2H3 |
| InChIKey | RHCOSBNXZSSPHT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |