C18H16N6O6 — CID 6310047
N,N'-bis[(Z)-1-(3-nitrophenyl)ethylideneamino]oxamide (PubChem CID 6310047) has the molecular formula C18H16N6O6 and a molecular weight of 412.36 g/mol. Its IUPAC name is N,N'-bis[(Z)-1-(3-nitrophenyl)ethylideneamino]oxamide.
| Compound Name | N,N'-bis[(Z)-1-(3-nitrophenyl)ethylideneamino]oxamide |
|---|---|
| PubChem CID | 6310047 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N,N'-bis[(Z)-1-(3-nitrophenyl)ethylideneamino]oxamide |
| SMILES | C/C(=N/NC(=O)C(=O)N/N=C(/C)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O6/c1-11(13-5-3-7-15(9-13)23(27)28)19-21-17(25)18(26)22-20-12(2)14-6-4-8-16(10-14)24(29)30/h3-10H,1-2H3,(H,21,25)(H,22,26)/b19-11-,20-12- |
| InChIKey | PNPOENJKMLPSDP-YZLQMOBTSA-N |
| XLogP | 1.88 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|