C17H20N2 — CID 63101061
1-(2-phenylethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 63101061) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(2-phenylethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1-(2-phenylethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 63101061 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-(2-phenylethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | c1ccc(CCN2CCNCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H20N2/c1-2-6-15(7-3-1)10-12-19-13-11-18-14-16-8-4-5-9-17(16)19/h1-9,18H,10-14H2 |
| InChIKey | OMNNCLUFRZGOJX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |