C12H6Cl4 — CID 63103
2,2',3,4'-Tetrachlorobiphenyl (PubChem CID 63103) has the molecular formula C12H6Cl4 and a molecular weight of 292.00 g/mol. Its IUPAC name is 1,2-dichloro-3-(2,4-dichlorophenyl)benzene.
| Compound Name | 2,2',3,4'-Tetrachlorobiphenyl |
|---|---|
| PubChem CID | 63103 |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 292.00 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 1,2-dichloro-3-(2,4-dichlorophenyl)benzene |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C12H6Cl4/c13-7-4-5-8(11(15)6-7)9-2-1-3-10(14)12(9)16/h1-6H |
| InChIKey | ALFHIHDQSYXSGP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 233 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.00 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |