C9H14N4O3 — CID 63103255
ethyl 2-[(4-amino-1H-pyrazole-5-carbonyl)-methylamino]acetate (PubChem CID 63103255) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is ethyl 2-[(4-amino-1H-pyrazole-5-carbonyl)-methylamino]acetate.
| Compound Name | ethyl 2-[(4-amino-1H-pyrazole-5-carbonyl)-methylamino]acetate |
|---|---|
| PubChem CID | 63103255 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethyl 2-[(4-amino-1H-pyrazole-5-carbonyl)-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C9H14N4O3/c1-3-16-7(14)5-13(2)9(15)8-6(10)4-11-12-8/h4H,3,5,10H2,1-2H3,(H,11,12) |
| InChIKey | WZPBTCIZPNWFKO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |