About N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide
N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide (PubChem CID 63103311) has the molecular formula C9H18N4O2
and a molecular weight of 214.27 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide |
| PubChem CID | 63103311 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)N(C)CC(N)=O)CN1 |
| InChI | InChI=1S/C9H18N4O2/c1-6-3-12-7(4-11-6)9(15)13(2)5-8(10)14/h6-7,11-12H,3-5H2,1-2H3,(H2,10,14) |
| InChIKey | DJZUFYXYFQMPFX-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide (CID 63103311) is N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide is CC1CNC(C(=O)N(C)CC(N)=O)CN1.
What is the InChIKey of N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide?
The InChIKey is DJZUFYXYFQMPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2/c1-6-3-12-7(4-11-6)9(15)13(2)5-8(10)14/h6-7,11-12H,3-5H2,1-2H3,(H2,10,14).
What are the key properties of N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide?
N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide has a molecular weight of 214.27 g/mol, XLogP of -2.12, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-N,5-dimethylpiperazine-2-carboxamide is sourced from PubChem (CID 63103311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).