C10H30O5Si5 — CID 631041
2,4,6,8,10-pentaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 631041) has the molecular formula C10H30O5Si5 and a molecular weight of 370.78 g/mol. Its IUPAC name is 2,4,6,8,10-pentaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 631041 |
| Molecular Formula | C10H30O5Si5 |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2,4,6,8,10-pentaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[SiH]1O[SiH](CC)O[SiH](CC)O[SiH](CC)O[SiH](CC)O1 |
| InChI | InChI=1S/C10H30O5Si5/c1-6-16-11-17(7-2)13-19(9-4)15-20(10-5)14-18(8-3)12-16/h16-20H,6-10H2,1-5H3 |
| InChIKey | PGSRCRCASLLTFK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|