About 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide
4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide (PubChem CID 63104149) has the molecular formula C8H11F3N4O
and a molecular weight of 236.20 g/mol. Its IUPAC name is 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
| PubChem CID | 63104149 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C8H11F3N4O/c1-2-15(4-8(9,10)11)7(16)6-5(12)3-13-14-6/h3H,2,4,12H2,1H3,(H,13,14) |
| InChIKey | SKWGFYXWASPYFB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide?
The IUPAC name of 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide (CID 63104149) is 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide?
The canonical SMILES for 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide is CCN(CC(F)(F)F)C(=O)c1[nH]ncc1N.
What is the InChIKey of 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide?
The InChIKey is SKWGFYXWASPYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N4O/c1-2-15(4-8(9,10)11)7(16)6-5(12)3-13-14-6/h3H,2,4,12H2,1H3,(H,13,14).
What are the key properties of 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide?
4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide has a molecular weight of 236.20 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 63104149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).