C8H12N4O2 — CID 63106204
1-(3-hydroxyazetidin-1-yl)-3-(triazol-1-yl)propan-1-one (PubChem CID 63106204) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(3-hydroxyazetidin-1-yl)-3-(triazol-1-yl)propan-1-one.
| Compound Name | 1-(3-hydroxyazetidin-1-yl)-3-(triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 63106204 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(3-hydroxyazetidin-1-yl)-3-(triazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1ccnn1)N1CC(O)C1 |
| InChI | InChI=1S/C8H12N4O2/c13-7-5-11(6-7)8(14)1-3-12-4-2-9-10-12/h2,4,7,13H,1,3,5-6H2 |
| InChIKey | RAJWELGWSDXJFJ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |