About [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol
[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol (PubChem CID 63108323) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol |
| PubChem CID | 63108323 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol |
| SMILES | Cc1nc(Cc2ncc(CO)[nH]2)cs1 |
| InChI | InChI=1S/C9H11N3OS/c1-6-11-7(5-14-6)2-9-10-3-8(4-13)12-9/h3,5,13H,2,4H2,1H3,(H,10,12) |
| InChIKey | YAHMPCNQNFEFKC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol?
The IUPAC name of [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol (CID 63108323) is [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol.
What is the SMILES notation for [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol?
The canonical SMILES for [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol is Cc1nc(Cc2ncc(CO)[nH]2)cs1.
What is the InChIKey of [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol?
The InChIKey is YAHMPCNQNFEFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-6-11-7(5-14-6)2-9-10-3-8(4-13)12-9/h3,5,13H,2,4H2,1H3,(H,10,12).
What are the key properties of [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol?
[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol has a molecular weight of 209.27 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazol-5-yl]methanol is sourced from PubChem (CID 63108323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).