About [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol
[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol (PubChem CID 63108385) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol |
| PubChem CID | 63108385 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol |
| SMILES | Cc1noc(C)c1-c1ncc(CO)[nH]1 |
| InChI | InChI=1S/C9H11N3O2/c1-5-8(6(2)14-12-5)9-10-3-7(4-13)11-9/h3,13H,4H2,1-2H3,(H,10,11) |
| InChIKey | PHCOLLOOVXSZBW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol?
The IUPAC name of [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol (CID 63108385) is [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol.
What is the SMILES notation for [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol?
The canonical SMILES for [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol is Cc1noc(C)c1-c1ncc(CO)[nH]1.
What is the InChIKey of [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol?
The InChIKey is PHCOLLOOVXSZBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-5-8(6(2)14-12-5)9-10-3-7(4-13)11-9/h3,13H,4H2,1-2H3,(H,10,11).
What are the key properties of [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol?
[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol has a molecular weight of 193.21 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-imidazol-5-yl]methanol is sourced from PubChem (CID 63108385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).