C13H25N3 — CID 63109067
2-methyl-N-[[2-(3-methylbutyl)-1H-imidazol-5-yl]methyl]propan-2-amine (PubChem CID 63109067) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-methyl-N-[[2-(3-methylbutyl)-1H-imidazol-5-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[2-(3-methylbutyl)-1H-imidazol-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63109067 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-methyl-N-[[2-(3-methylbutyl)-1H-imidazol-5-yl]methyl]propan-2-amine |
| SMILES | CC(C)CCc1ncc(CNC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C13H25N3/c1-10(2)6-7-12-14-8-11(16-12)9-15-13(3,4)5/h8,10,15H,6-7,9H2,1-5H3,(H,14,16) |
| InChIKey | CVHUMBOKQPNKRE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |