About 2-isocyanatopropanamide
2-isocyanatopropanamide (PubChem CID 63109882) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-isocyanatopropanamide.
Molecular Properties
| Compound Name | 2-isocyanatopropanamide |
| PubChem CID | 63109882 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 2-isocyanatopropanamide |
| SMILES | CC(N=C=O)C(N)=O |
| InChI | InChI=1S/C4H6N2O2/c1-3(4(5)8)6-2-7/h3H,1H3,(H2,5,8) |
| InChIKey | AXXNPSVRPXDURD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatopropanamide?
The IUPAC name of 2-isocyanatopropanamide (CID 63109882) is 2-isocyanatopropanamide.
What is the SMILES notation for 2-isocyanatopropanamide?
The canonical SMILES for 2-isocyanatopropanamide is CC(N=C=O)C(N)=O.
What is the InChIKey of 2-isocyanatopropanamide?
The InChIKey is AXXNPSVRPXDURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-3(4(5)8)6-2-7/h3H,1H3,(H2,5,8).
What are the key properties of 2-isocyanatopropanamide?
2-isocyanatopropanamide has a molecular weight of 114.10 g/mol, XLogP of -0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatopropanamide is sourced from PubChem (CID 63109882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).