C13H15IN2O3 — CID 63110712
5-iodo-2-[(1-methylpyrrolidine-3-carbonyl)amino]benzoic acid (PubChem CID 63110712) has the molecular formula C13H15IN2O3 and a molecular weight of 374.18 g/mol. Its IUPAC name is 5-iodo-2-[(1-methylpyrrolidine-3-carbonyl)amino]benzoic acid.
| Compound Name | 5-iodo-2-[(1-methylpyrrolidine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63110712 |
| Molecular Formula | C13H15IN2O3 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 5-iodo-2-[(1-methylpyrrolidine-3-carbonyl)amino]benzoic acid |
| SMILES | CN1CCC(C(=O)Nc2ccc(I)cc2C(=O)O)C1 |
| InChI | InChI=1S/C13H15IN2O3/c1-16-5-4-8(7-16)12(17)15-11-3-2-9(14)6-10(11)13(18)19/h2-3,6,8H,4-5,7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | CTPVSYZCLWMLEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|