C12H9IN4S — CID 63111672
4-iodo-2-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 63111672) has the molecular formula C12H9IN4S and a molecular weight of 368.20 g/mol. Its IUPAC name is 4-iodo-2-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-iodo-2-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 63111672 |
| Molecular Formula | C12H9IN4S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 4-iodo-2-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Nc1ccc(I)cc1-c1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C12H9IN4S/c13-7-3-4-9(14)8(6-7)11-15-12(17-16-11)10-2-1-5-18-10/h1-6H,14H2,(H,15,16,17) |
| InChIKey | DRPGLQMYBTUFFO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|