C9H8Br2N4 — CID 63111859
2,4-dibromo-6-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 63111859) has the molecular formula C9H8Br2N4 and a molecular weight of 332.00 g/mol. Its IUPAC name is 2,4-dibromo-6-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2,4-dibromo-6-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 63111859 |
| Molecular Formula | C9H8Br2N4 |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 2,4-dibromo-6-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nc(-c2cc(Br)cc(Br)c2N)n[nH]1 |
| InChI | InChI=1S/C9H8Br2N4/c1-4-13-9(15-14-4)6-2-5(10)3-7(11)8(6)12/h2-3H,12H2,1H3,(H,13,14,15) |
| InChIKey | VKMRQZSDBZZZNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|