3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid

C15H22N2O3 — CID 63112633

IUPAC3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid
SMILESCCC(CC)NC(=O)Nc1c(C)cc(C)cc1C(=O)O
InChIInChI=1S/C15H22N2O3/c1-5-11(6-2)16-15(20)17-13-10(4)7-9(3)8-12(13)14(18)19/h7-8,11H,5-6H2,1-4H3,(H,18,19)(H2,16,17,20)
InChIKeyZOBCRWQDPCPNHF-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.31
Rot. Bonds5

About 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid

3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid (PubChem CID 63112633) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid
PubChem CID63112633
Molecular FormulaC15H22N2O3
Molecular Weight278.35 g/mol
Exact Mass278.16
IUPAC Name3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid
SMILESCCC(CC)NC(=O)Nc1c(C)cc(C)cc1C(=O)O
InChIInChI=1S/C15H22N2O3/c1-5-11(6-2)16-15(20)17-13-10(4)7-9(3)8-12(13)14(18)19/h7-8,11H,5-6H2,1-4H3,(H,18,19)(H2,16,17,20)
InChIKeyZOBCRWQDPCPNHF-UHFFFAOYSA-N
XLogP3.31
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid?
The IUPAC name of 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid (CID 63112633) is 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid.
What is the SMILES notation for 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid?
The canonical SMILES for 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid is CCC(CC)NC(=O)Nc1c(C)cc(C)cc1C(=O)O.
What is the InChIKey of 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid?
The InChIKey is ZOBCRWQDPCPNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-5-11(6-2)16-15(20)17-13-10(4)7-9(3)8-12(13)14(18)19/h7-8,11H,5-6H2,1-4H3,(H,18,19)(H2,16,17,20).
What are the key properties of 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid?
3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid has a molecular weight of 278.35 g/mol, XLogP of 3.31, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-(pentan-3-ylcarbamoylamino)benzoic acid is sourced from PubChem (CID 63112633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).