About cyclobutyl 2-amino-3,5-dimethylbenzoate
cyclobutyl 2-amino-3,5-dimethylbenzoate (PubChem CID 63112719) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is cyclobutyl 2-amino-3,5-dimethylbenzoate.
Molecular Properties
| Compound Name | cyclobutyl 2-amino-3,5-dimethylbenzoate |
| PubChem CID | 63112719 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | cyclobutyl 2-amino-3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)c(N)c(C(=O)OC2CCC2)c1 |
| InChI | InChI=1S/C13H17NO2/c1-8-6-9(2)12(14)11(7-8)13(15)16-10-4-3-5-10/h6-7,10H,3-5,14H2,1-2H3 |
| InChIKey | PTTNSMSPYRQJIP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyl 2-amino-3,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl 2-amino-3,5-dimethylbenzoate?
The IUPAC name of cyclobutyl 2-amino-3,5-dimethylbenzoate (CID 63112719) is cyclobutyl 2-amino-3,5-dimethylbenzoate.
What is the SMILES notation for cyclobutyl 2-amino-3,5-dimethylbenzoate?
The canonical SMILES for cyclobutyl 2-amino-3,5-dimethylbenzoate is Cc1cc(C)c(N)c(C(=O)OC2CCC2)c1.
What is the InChIKey of cyclobutyl 2-amino-3,5-dimethylbenzoate?
The InChIKey is PTTNSMSPYRQJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-8-6-9(2)12(14)11(7-8)13(15)16-10-4-3-5-10/h6-7,10H,3-5,14H2,1-2H3.
What are the key properties of cyclobutyl 2-amino-3,5-dimethylbenzoate?
cyclobutyl 2-amino-3,5-dimethylbenzoate has a molecular weight of 219.28 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 2-amino-3,5-dimethylbenzoate is sourced from PubChem (CID 63112719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).