C14H21N3O3S — CID 63113816
2-[[(1-ethylpiperidin-4-yl)-methylcarbamoyl]amino]thiophene-3-carboxylic acid (PubChem CID 63113816) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[[(1-ethylpiperidin-4-yl)-methylcarbamoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(1-ethylpiperidin-4-yl)-methylcarbamoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63113816 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[(1-ethylpiperidin-4-yl)-methylcarbamoyl]amino]thiophene-3-carboxylic acid |
| SMILES | CCN1CCC(N(C)C(=O)Nc2sccc2C(=O)O)CC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-17-7-4-10(5-8-17)16(2)14(20)15-12-11(13(18)19)6-9-21-12/h6,9-10H,3-5,7-8H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | SUGZSJIUSCKXSX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |