C11H17N3O5S2 — CID 63114718
4,5-dimethyl-2-(3-sulfamoylpropylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 63114718) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4,5-dimethyl-2-(3-sulfamoylpropylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4,5-dimethyl-2-(3-sulfamoylpropylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114718 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4,5-dimethyl-2-(3-sulfamoylpropylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | Cc1sc(NC(=O)NCCCS(N)(=O)=O)c(C(=O)O)c1C |
| InChI | InChI=1S/C11H17N3O5S2/c1-6-7(2)20-9(8(6)10(15)16)14-11(17)13-4-3-5-21(12,18)19/h3-5H2,1-2H3,(H,15,16)(H2,12,18,19)(H2,13,14,17) |
| InChIKey | GNHGCPJAIMYLAF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|