C13H18ClNS — CID 63115096
2-(2-chlorophenyl)-2-cyclopentylsulfanylethanamine (PubChem CID 63115096) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-cyclopentylsulfanylethanamine.
| Compound Name | 2-(2-chlorophenyl)-2-cyclopentylsulfanylethanamine |
|---|---|
| PubChem CID | 63115096 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(2-chlorophenyl)-2-cyclopentylsulfanylethanamine |
| SMILES | NCC(SC1CCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClNS/c14-12-8-4-3-7-11(12)13(9-15)16-10-5-1-2-6-10/h3-4,7-8,10,13H,1-2,5-6,9,15H2 |
| InChIKey | IHLJSNQEFPPYHP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |