About 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine
3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine (PubChem CID 63115207) has the molecular formula C9H16F3NS
and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine.
Molecular Properties
| Compound Name | 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine |
| PubChem CID | 63115207 |
| Molecular Formula | C9H16F3NS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(N)C(SC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NS/c1-6(13)8(9(10,11)12)14-7-4-2-3-5-7/h6-8H,2-5,13H2,1H3 |
| InChIKey | GTGNHHVUMDXWNT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine?
The IUPAC name of 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine (CID 63115207) is 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine.
What is the SMILES notation for 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine?
The canonical SMILES for 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine is CC(N)C(SC1CCCC1)C(F)(F)F.
What is the InChIKey of 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine?
The InChIKey is GTGNHHVUMDXWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NS/c1-6(13)8(9(10,11)12)14-7-4-2-3-5-7/h6-8H,2-5,13H2,1H3.
What are the key properties of 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine?
3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine has a molecular weight of 227.29 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylsulfanyl-4,4,4-trifluorobutan-2-amine is sourced from PubChem (CID 63115207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).