C11H21NO2S — CID 63115875
3-cyclopentylsulfanyl-2-(propan-2-ylamino)propanoic acid (PubChem CID 63115875) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 3-cyclopentylsulfanyl-2-(propan-2-ylamino)propanoic acid.
| Compound Name | 3-cyclopentylsulfanyl-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 63115875 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-cyclopentylsulfanyl-2-(propan-2-ylamino)propanoic acid |
| SMILES | CC(C)NC(CSC1CCCC1)C(=O)O |
| InChI | InChI=1S/C11H21NO2S/c1-8(2)12-10(11(13)14)7-15-9-5-3-4-6-9/h8-10,12H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | YCJJAIOAWXAWIR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |