C13H21NOS — CID 63115985
2-cyclopentylsulfanyl-N-(furan-2-ylmethyl)propan-1-amine (PubChem CID 63115985) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-(furan-2-ylmethyl)propan-1-amine.
| Compound Name | 2-cyclopentylsulfanyl-N-(furan-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 63115985 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-(furan-2-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1ccco1)SC1CCCC1 |
| InChI | InChI=1S/C13H21NOS/c1-11(16-13-6-2-3-7-13)9-14-10-12-5-4-8-15-12/h4-5,8,11,13-14H,2-3,6-7,9-10H2,1H3 |
| InChIKey | YMOLPQBPESGBBU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |