C13H18N2O3 — CID 63116322
4-amino-2-(3,3-dimethylbutanoylamino)benzoic acid (PubChem CID 63116322) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-amino-2-(3,3-dimethylbutanoylamino)benzoic acid.
| Compound Name | 4-amino-2-(3,3-dimethylbutanoylamino)benzoic acid |
|---|---|
| PubChem CID | 63116322 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-amino-2-(3,3-dimethylbutanoylamino)benzoic acid |
| SMILES | CC(C)(C)CC(=O)Nc1cc(N)ccc1C(=O)O |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,3)7-11(16)15-10-6-8(14)4-5-9(10)12(17)18/h4-6H,7,14H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | UNSHODRYJISJPK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|