C17H25N3O — CID 63116738
5-amino-N-(2,4,4-trimethylpentan-2-yl)-1H-indole-3-carboxamide (PubChem CID 63116738) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 5-amino-N-(2,4,4-trimethylpentan-2-yl)-1H-indole-3-carboxamide.
| Compound Name | 5-amino-N-(2,4,4-trimethylpentan-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63116738 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 5-amino-N-(2,4,4-trimethylpentan-2-yl)-1H-indole-3-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C17H25N3O/c1-16(2,3)10-17(4,5)20-15(21)13-9-19-14-7-6-11(18)8-12(13)14/h6-9,19H,10,18H2,1-5H3,(H,20,21) |
| InChIKey | GBMONZQMCHPBHD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|