C14H15N5O — CID 63116868
5-amino-N-[(1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide (PubChem CID 63116868) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-amino-N-[(1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide.
| Compound Name | 5-amino-N-[(1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63116868 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-amino-N-[(1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2c[nH]c3ccc(N)cc23)cn1 |
| InChI | InChI=1S/C14H15N5O/c1-19-8-9(6-18-19)5-17-14(20)12-7-16-13-3-2-10(15)4-11(12)13/h2-4,6-8,16H,5,15H2,1H3,(H,17,20) |
| InChIKey | JZFIJUKAVDGWNB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|