C14H27NO2S — CID 63120139
methyl 3-(cyclopentylmethylsulfanyl)-2-methyl-2-(propan-2-ylamino)propanoate (PubChem CID 63120139) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is methyl 3-(cyclopentylmethylsulfanyl)-2-methyl-2-(propan-2-ylamino)propanoate.
| Compound Name | methyl 3-(cyclopentylmethylsulfanyl)-2-methyl-2-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 63120139 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | methyl 3-(cyclopentylmethylsulfanyl)-2-methyl-2-(propan-2-ylamino)propanoate |
| SMILES | COC(=O)C(C)(CSCC1CCCC1)NC(C)C |
| InChI | InChI=1S/C14H27NO2S/c1-11(2)15-14(3,13(16)17-4)10-18-9-12-7-5-6-8-12/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | KYCZJIUHVAXZRM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |