C14H16N4O3 — CID 63121112
methyl 6-[3-(2-aminoethoxy)anilino]pyridazine-3-carboxylate (PubChem CID 63121112) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is methyl 6-[3-(2-aminoethoxy)anilino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[3-(2-aminoethoxy)anilino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 63121112 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 6-[3-(2-aminoethoxy)anilino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2cccc(OCCN)c2)nn1 |
| InChI | InChI=1S/C14H16N4O3/c1-20-14(19)12-5-6-13(18-17-12)16-10-3-2-4-11(9-10)21-8-7-15/h2-6,9H,7-8,15H2,1H3,(H,16,18) |
| InChIKey | ICCQXVBTEMLVRG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |