About Arborine
Arborine (PubChem CID 63123) has the molecular formula C16H14N2O
and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-benzyl-1-methylquinazolin-4-one.
Molecular Properties
| Compound Name | Arborine |
| PubChem CID | 63123 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-benzyl-1-methylquinazolin-4-one |
| SMILES | CN1C2=CC=CC=C2C(=O)N=C1CC3=CC=CC=C3 |
| InChI | InChI=1S/C16H14N2O/c1-18-14-10-6-5-9-13(14)16(19)17-15(18)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3 |
| InChIKey | XVPZRKIQCKKYNE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 371 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Arborine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Arborine?
The IUPAC name of Arborine (CID 63123) is 2-benzyl-1-methylquinazolin-4-one.
What is the SMILES notation for Arborine?
The canonical SMILES for Arborine is CN1C2=CC=CC=C2C(=O)N=C1CC3=CC=CC=C3.
What is the InChIKey of Arborine?
The InChIKey is XVPZRKIQCKKYNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c1-18-14-10-6-5-9-13(14)16(19)17-15(18)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3.
What are the key properties of Arborine?
Arborine has a molecular weight of 250.29 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Arborine is sourced from PubChem (CID 63123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).