C11H19NO2 — CID 63124469
1-but-3-en-2-yl-4-methylpiperidine-4-carboxylic acid (PubChem CID 63124469) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-but-3-en-2-yl-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-but-3-en-2-yl-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63124469 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-but-3-en-2-yl-4-methylpiperidine-4-carboxylic acid |
| SMILES | C=CC(C)N1CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO2/c1-4-9(2)12-7-5-11(3,6-8-12)10(13)14/h4,9H,1,5-8H2,2-3H3,(H,13,14) |
| InChIKey | HYDIARFHOABDFG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|