About 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid
1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid (PubChem CID 63124530) has the molecular formula C11H19NO4S
and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid |
| PubChem CID | 63124530 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H19NO4S/c1-11(10(13)14)3-5-12(6-4-11)9-2-7-17(15,16)8-9/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | VISCONHSHWXQQG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid (CID 63124530) is 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid is CC1(C(=O)O)CCN(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid?
The InChIKey is VISCONHSHWXQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4S/c1-11(10(13)14)3-5-12(6-4-11)9-2-7-17(15,16)8-9/h9H,2-8H2,1H3,(H,13,14).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid?
1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid has a molecular weight of 261.34 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-4-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 63124530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).