About 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid
1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 63124843) has the molecular formula C13H22N2O5S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid |
| PubChem CID | 63124843 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(CC(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H22N2O5S/c1-13(12(17)18)3-5-15(6-4-13)8-11(16)14-10-2-7-21(19,20)9-10/h10H,2-9H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | BAOZRCYGIILCRM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid (CID 63124843) is 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid is CC1(C(=O)O)CCN(CC(=O)NC2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid?
The InChIKey is BAOZRCYGIILCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O5S/c1-13(12(17)18)3-5-15(6-4-13)8-11(16)14-10-2-7-21(19,20)9-10/h10H,2-9H2,1H3,(H,14,16)(H,17,18).
What are the key properties of 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid?
1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid has a molecular weight of 318.40 g/mol, XLogP of -0.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-4-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 63124843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).