C13H22N2O4S — CID 63125337
1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-4-ethylpiperidine-4-carboxylic acid (PubChem CID 63125337) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-4-ethylpiperidine-4-carboxylic acid.
| Compound Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-4-ethylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63125337 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-4-ethylpiperidine-4-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(C(=O)CCSCC(N)=O)CC1 |
| InChI | InChI=1S/C13H22N2O4S/c1-2-13(12(18)19)4-6-15(7-5-13)11(17)3-8-20-9-10(14)16/h2-9H2,1H3,(H2,14,16)(H,18,19) |
| InChIKey | ACWSNBGIUVYJHW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|