C22H22N4Ni — CID 6312597
nickel(2+);(4Z,15Z)-3,5,14,16-tetramethyl-2,13-diaza-6,17-diazanidatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene (PubChem CID 6312597) has the molecular formula C22H22N4Ni and a molecular weight of 401.14 g/mol. Its IUPAC name is nickel(2+);(4Z,15Z)-3,5,14,16-tetramethyl-2,13-diaza-6,17-diazanidatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene.
| Compound Name | nickel(2+);(4Z,15Z)-3,5,14,16-tetramethyl-2,13-diaza-6,17-diazanidatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene |
|---|---|
| PubChem CID | 6312597 |
| Molecular Formula | C22H22N4Ni |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | nickel(2+);(4Z,15Z)-3,5,14,16-tetramethyl-2,13-diaza-6,17-diazanidatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene |
| SMILES | C/C1=C/C(C)=N/c2ccccc2[N-]/C(C)=C\C(C)=N\c2ccccc2[N-]1.[Ni+2] |
| InChI | InChI=1S/C22H22N4.Ni/c1-15-13-16(2)24-21-11-7-8-12-22(21)26-18(4)14-17(3)25-20-10-6-5-9-19(20)23-15;/h5-14H,1-4H3;/q-2;+2/b15-13-,18-14-,24-16+,25-17+; |
| InChIKey | GHJXMPZOKUOEEY-SHBXHWNHSA-N |
| XLogP | 7.40 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |