C28H40 — CID 6312640
1,2,3,4,5-pentamethyl-6-[(E)-4-(2,3,4,5,6-pentamethylphenyl)hex-3-en-3-yl]benzene (PubChem CID 6312640) has the molecular formula C28H40 and a molecular weight of 376.63 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[(E)-4-(2,3,4,5,6-pentamethylphenyl)hex-3-en-3-yl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[(E)-4-(2,3,4,5,6-pentamethylphenyl)hex-3-en-3-yl]benzene |
|---|---|
| PubChem CID | 6312640 |
| Molecular Formula | C28H40 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[(E)-4-(2,3,4,5,6-pentamethylphenyl)hex-3-en-3-yl]benzene |
| SMILES | CC/C(=C(/CC)c1c(C)c(C)c(C)c(C)c1C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C28H40/c1-13-25(27-21(9)17(5)15(3)18(6)22(27)10)26(14-2)28-23(11)19(7)16(4)20(8)24(28)12/h13-14H2,1-12H3/b26-25+ |
| InChIKey | IHZBGUCYIVVWRP-OCEACIFDSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|