About 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid
4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid (PubChem CID 63126857) has the molecular formula C11H18F3NO2
and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid |
| PubChem CID | 63126857 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO2/c1-2-3-10(9(16)17)4-6-15(7-5-10)8-11(12,13)14/h2-8H2,1H3,(H,16,17) |
| InChIKey | NGPKTUATBBXBHH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid (CID 63126857) is 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid is CCCC1(C(=O)O)CCN(CC(F)(F)F)CC1.
What is the InChIKey of 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid?
The InChIKey is NGPKTUATBBXBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c1-2-3-10(9(16)17)4-6-15(7-5-10)8-11(12,13)14/h2-8H2,1H3,(H,16,17).
What are the key properties of 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid?
4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid has a molecular weight of 253.26 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 63126857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).