About 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid
4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid (PubChem CID 63127165) has the molecular formula C13H22F3NO3
and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid |
| PubChem CID | 63127165 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO3/c1-2-3-12(11(18)19)4-6-17(7-5-12)8-9-20-10-13(14,15)16/h2-10H2,1H3,(H,18,19) |
| InChIKey | ZDCRFLMPQWDNNP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid?
The IUPAC name of 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid (CID 63127165) is 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid?
The canonical SMILES for 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid is CCCC1(C(=O)O)CCN(CCOCC(F)(F)F)CC1.
What is the InChIKey of 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid?
The InChIKey is ZDCRFLMPQWDNNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO3/c1-2-3-12(11(18)19)4-6-17(7-5-12)8-9-20-10-13(14,15)16/h2-10H2,1H3,(H,18,19).
What are the key properties of 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid?
4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid has a molecular weight of 297.32 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 63127165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).