C19H19NO — CID 6312731
(1Z,3Z,5Z)-N-methyl-7-phenylbicyclo[5.3.1]undeca-1,3,5,8-tetraene-8-carboxamide (PubChem CID 6312731) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (1Z,3Z,5Z)-N-methyl-7-phenylbicyclo[5.3.1]undeca-1,3,5,8-tetraene-8-carboxamide.
| Compound Name | (1Z,3Z,5Z)-N-methyl-7-phenylbicyclo[5.3.1]undeca-1,3,5,8-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 6312731 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (1Z,3Z,5Z)-N-methyl-7-phenylbicyclo[5.3.1]undeca-1,3,5,8-tetraene-8-carboxamide |
| SMILES | CNC(=O)C1=CC/C2=C/C=C\C=C/C1(c1ccccc1)C2 |
| InChI | InChI=1S/C19H19NO/c1-20-18(21)17-12-11-15-8-4-3-7-13-19(17,14-15)16-9-5-2-6-10-16/h2-10,12-13H,11,14H2,1H3,(H,20,21)/b4-3-,13-7-,15-8- |
| InChIKey | XSJUDZSUMLOYQR-YKKGAICASA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |