About (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide
(E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide (PubChem CID 6312765) has the molecular formula C11H12BrNO
and a molecular weight of 254.13 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide |
| PubChem CID | 6312765 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNO/c1-13(2)11(14)8-5-9-3-6-10(12)7-4-9/h3-8H,1-2H3/b8-5+ |
| InChIKey | ZESQHCHWETWKBZ-VMPITWQZSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide?
The IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide (CID 6312765) is (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide.
What is the SMILES notation for (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide?
The canonical SMILES for (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide is CN(C)C(=O)/C=C/c1ccc(Br)cc1.
What is the InChIKey of (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide?
The InChIKey is ZESQHCHWETWKBZ-VMPITWQZSA-N. The full InChI is InChI=1S/C11H12BrNO/c1-13(2)11(14)8-5-9-3-6-10(12)7-4-9/h3-8H,1-2H3/b8-5+.
What are the key properties of (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide?
(E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide has a molecular weight of 254.13 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide is sourced from PubChem (CID 6312765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).