C16H13F5N2O — CID 631283
1-[5'-methyl-2-(1,1,2,2,2-pentafluoroethyl)spiro[2H-pyrrole-3,3'-indole]-1-yl]ethanone (PubChem CID 631283) has the molecular formula C16H13F5N2O and a molecular weight of 344.28 g/mol. Its IUPAC name is 1-[5'-methyl-2-(1,1,2,2,2-pentafluoroethyl)spiro[2H-pyrrole-3,3'-indole]-1-yl]ethanone.
| Compound Name | 1-[5'-methyl-2-(1,1,2,2,2-pentafluoroethyl)spiro[2H-pyrrole-3,3'-indole]-1-yl]ethanone |
|---|---|
| PubChem CID | 631283 |
| Molecular Formula | C16H13F5N2O |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[5'-methyl-2-(1,1,2,2,2-pentafluoroethyl)spiro[2H-pyrrole-3,3'-indole]-1-yl]ethanone |
| SMILES | CC(=O)N1C=CC2(C=Nc3ccc(C)cc32)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F5N2O/c1-9-3-4-12-11(7-9)14(8-22-12)5-6-23(10(2)24)13(14)15(17,18)16(19,20)21/h3-8,13H,1-2H3 |
| InChIKey | IGQVODNUNVBLQY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|