C13H8Cl4O2 — CID 6312852
(4Z)-2,3,5,5-tetrachloro-4-(5-oxatricyclo[4.3.0.03,7]non-8-en-4-ylidene)cyclopent-2-en-1-one (PubChem CID 6312852) has the molecular formula C13H8Cl4O2 and a molecular weight of 338.02 g/mol. Its IUPAC name is (4Z)-2,3,5,5-tetrachloro-4-(5-oxatricyclo[4.3.0.03,7]non-8-en-4-ylidene)cyclopent-2-en-1-one.
| Compound Name | (4Z)-2,3,5,5-tetrachloro-4-(5-oxatricyclo[4.3.0.03,7]non-8-en-4-ylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 6312852 |
| Molecular Formula | C13H8Cl4O2 |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | (4Z)-2,3,5,5-tetrachloro-4-(5-oxatricyclo[4.3.0.03,7]non-8-en-4-ylidene)cyclopent-2-en-1-one |
| SMILES | O=C1C(Cl)=C(Cl)/C(=C2/OC3C4C=CC3C2C4)C1(Cl)Cl |
| InChI | InChI=1S/C13H8Cl4O2/c14-8-7(13(16,17)12(18)9(8)15)11-6-3-4-1-2-5(6)10(4)19-11/h1-2,4-6,10H,3H2/b11-7- |
| InChIKey | DHGHRSVYGYDVCR-XFFZJAGNSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|